C19H21F3N4 — CID 136900600
1-ethyl-2-(2-pyrrol-1-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 136900600) has the molecular formula C19H21F3N4 and a molecular weight of 362.40 g/mol. Its IUPAC name is 1-ethyl-2-(2-pyrrol-1-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1-ethyl-2-(2-pyrrol-1-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 136900600 |
| Molecular Formula | C19H21F3N4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-ethyl-2-(2-pyrrol-1-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | CCN/C(=N\CCn1cccc1)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N4/c1-2-23-18(25-11-14-26-12-3-4-13-26)24-10-6-8-16-7-5-9-17(15-16)19(20,21)22/h3-5,7,9,12-13,15H,2,10-11,14H2,1H3,(H2,23,24,25) |
| InChIKey | BSFXATILDNBLQM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|