C21H28F3N3O2 — CID 136920291
1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 136920291) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 136920291 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CCOC1)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H28F3N3O2/c1-2-25-20(27-11-5-12-28-15-18-9-13-29-16-18)26-10-4-7-17-6-3-8-19(14-17)21(22,23)24/h3,6,8,14,18H,2,5,9-13,15-16H2,1H3,(H2,25,26,27) |
| InChIKey | NAUVFVJNIDJUPN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|