C18H19F3N4 — CID 111990519
2-methyl-1-[(1-methylpyrrol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111990519) has the molecular formula C18H19F3N4 and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-methyl-1-[(1-methylpyrrol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 2-methyl-1-[(1-methylpyrrol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111990519 |
| Molecular Formula | C18H19F3N4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-methyl-1-[(1-methylpyrrol-3-yl)methyl]-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | C/N=C(/NCC#Cc1cccc(C(F)(F)F)c1)NCc1ccn(C)c1 |
| InChI | InChI=1S/C18H19F3N4/c1-22-17(24-12-15-8-10-25(2)13-15)23-9-4-6-14-5-3-7-16(11-14)18(19,20)21/h3,5,7-8,10-11,13H,9,12H2,1-2H3,(H2,22,23,24) |
| InChIKey | OPLUJFMKHLLPQP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|