C22H23F3N4O — CID 111987311
N-methyl-3-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111987311) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is N-methyl-3-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N-methyl-3-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111987311 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-methyl-3-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCC#Cc1cccc(C(F)(F)F)c1)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C22H23F3N4O/c1-26-20(30)18-9-3-6-17(14-18)11-13-29-21(27-2)28-12-5-8-16-7-4-10-19(15-16)22(23,24)25/h3-4,6-7,9-10,14-15H,11-13H2,1-2H3,(H,26,30)(H2,27,28,29) |
| InChIKey | PVENDDQYAWPWOJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|