C22H29BrN4O — CID 111634425
3-[2-[[N-[2-(3-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111634425) has the molecular formula C22H29BrN4O and a molecular weight of 445.41 g/mol. Its IUPAC name is 3-[2-[[N-[2-(3-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-[2-(3-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111634425 |
| Molecular Formula | C22H29BrN4O |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-[2-[[N-[2-(3-bromophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)NC)c1)NCC(C)(C)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H29BrN4O/c1-22(2,18-9-6-10-19(23)14-18)15-27-21(25-4)26-12-11-16-7-5-8-17(13-16)20(28)24-3/h5-10,13-14H,11-12,15H2,1-4H3,(H,24,28)(H2,25,26,27) |
| InChIKey | RITIQWCOIFNHOA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|