C20H25BrFIN4O — CID 111632838
3-[2-[[N-[2-(3-bromo-4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111632838) has the molecular formula C20H25BrFIN4O and a molecular weight of 563.25 g/mol. Its IUPAC name is 3-[2-[[N-[2-(3-bromo-4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N-[2-(3-bromo-4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111632838 |
| Molecular Formula | C20H25BrFIN4O |
| Molecular Weight | 563.25 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 3-[2-[[N-[2-(3-bromo-4-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)NC)c1)NCCc1ccc(F)c(Br)c1.I |
| InChI | InChI=1S/C20H24BrFN4O.HI/c1-23-19(27)16-5-3-4-14(12-16)8-10-25-20(24-2)26-11-9-15-6-7-18(22)17(21)13-15;/h3-7,12-13H,8-11H2,1-2H3,(H,23,27)(H2,24,25,26);1H |
| InChIKey | ZCBLSUVVSGYBAP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|