C19H22BrFN4O — CID 111632907
3-[2-[[N-[(5-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111632907) has the molecular formula C19H22BrFN4O and a molecular weight of 421.31 g/mol. Its IUPAC name is 3-[2-[[N-[(5-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-[(5-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111632907 |
| Molecular Formula | C19H22BrFN4O |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 3-[2-[[N-[(5-bromo-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)NC)c1)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C19H22BrFN4O/c1-22-18(26)14-5-3-4-13(10-14)8-9-24-19(23-2)25-12-15-11-16(20)6-7-17(15)21/h3-7,10-11H,8-9,12H2,1-2H3,(H,22,26)(H2,23,24,25) |
| InChIKey | BSQQUJPYOTUXIX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|