C18H21FN4O — CID 111266271
3-[[[N-[(2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide (PubChem CID 111266271) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-[[[N-[(2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[N-[(2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111266271 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-[[[N-[(2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NC)c1)NCc1ccccc1F |
| InChI | InChI=1S/C18H21FN4O/c1-20-17(24)14-8-5-6-13(10-14)11-22-18(21-2)23-12-15-7-3-4-9-16(15)19/h3-10H,11-12H2,1-2H3,(H,20,24)(H2,21,22,23) |
| InChIKey | ANAKQAYFQWLLMS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|