C16H20N4OS — CID 111940417
N-methyl-3-[[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide (PubChem CID 111940417) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-methyl-3-[[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-methyl-3-[[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111940417 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-methyl-3-[[[N'-methyl-N-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccsc1)NCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C16H20N4OS/c1-17-15(21)14-5-3-4-12(8-14)9-19-16(18-2)20-10-13-6-7-22-11-13/h3-8,11H,9-10H2,1-2H3,(H,17,21)(H2,18,19,20) |
| InChIKey | HJXLLBWJOYDNPI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|