C16H21IN4OS — CID 111259432
N-methyl-3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111259432) has the molecular formula C16H21IN4OS and a molecular weight of 444.34 g/mol. Its IUPAC name is N-methyl-3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-methyl-3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111259432 |
| Molecular Formula | C16H21IN4OS |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | N-methyl-3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NC)c1)NCc1cccs1.I |
| InChI | InChI=1S/C16H20N4OS.HI/c1-17-15(21)13-6-3-5-12(9-13)10-19-16(18-2)20-11-14-7-4-8-22-14;/h3-9H,10-11H2,1-2H3,(H,17,21)(H2,18,19,20);1H |
| InChIKey | MKDDRXXPLWEIJT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|