C17H23IN4OS — CID 111257466
3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111257466) has the molecular formula C17H23IN4OS and a molecular weight of 458.37 g/mol. Its IUPAC name is 3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111257466 |
| Molecular Formula | C17H23IN4OS |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)NCc1cccs1.I |
| InChI | InChI=1S/C17H22N4OS.HI/c1-3-19-17(21-12-15-8-5-9-23-15)20-11-13-6-4-7-14(10-13)16(22)18-2;/h4-10H,3,11-12H2,1-2H3,(H,18,22)(H2,19,20,21);1H |
| InChIKey | VLMGJQGEDNVKPO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|