C22H31IN4O4 — CID 111377728
3-[[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111377728) has the molecular formula C22H31IN4O4 and a molecular weight of 542.42 g/mol. Its IUPAC name is 3-[[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111377728 |
| Molecular Formula | C22H31IN4O4 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 3-[[[N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C22H30N4O4.HI/c1-6-24-22(25-13-15-8-7-9-17(10-15)21(27)23-2)26-14-16-11-18(28-3)20(30-5)19(12-16)29-4;/h7-12H,6,13-14H2,1-5H3,(H,23,27)(H2,24,25,26);1H |
| InChIKey | JYMPWVUEOWLKDO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|