C20H27IN4O — CID 111900292
3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111900292) has the molecular formula C20H27IN4O and a molecular weight of 466.37 g/mol. Its IUPAC name is 3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111900292 |
| Molecular Formula | C20H27IN4O |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 3-[[[N-ethyl-N'-[(3-methylphenyl)methyl]carbamimidoyl]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)NCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C20H26N4O.HI/c1-4-22-20(23-13-16-8-5-7-15(2)11-16)24-14-17-9-6-10-18(12-17)19(25)21-3;/h5-12H,4,13-14H2,1-3H3,(H,21,25)(H2,22,23,24);1H |
| InChIKey | VJPHZIIKCDROSA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|