C18H24N4OS — CID 111260083
3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide (PubChem CID 111260083) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide.
| Compound Name | 3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 111260083 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(CN/C(=N/C)NCc2cccs2)c1 |
| InChI | InChI=1S/C18H24N4OS/c1-3-9-20-17(23)15-7-4-6-14(11-15)12-21-18(19-2)22-13-16-8-5-10-24-16/h4-8,10-11H,3,9,12-13H2,1-2H3,(H,20,23)(H2,19,21,22) |
| InChIKey | VZEDFSAFZHXVPM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|