C23H33N5OS — CID 111011665
3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide (PubChem CID 111011665) has the molecular formula C23H33N5OS and a molecular weight of 427.62 g/mol. Its IUPAC name is 3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide.
| Compound Name | 3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 111011665 |
| Molecular Formula | C23H33N5OS |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(CN/C(=N/C)NCC(c2cccs2)N2CCCC2)c1 |
| InChI | InChI=1S/C23H33N5OS/c1-3-11-25-22(29)19-9-6-8-18(15-19)16-26-23(24-2)27-17-20(21-10-7-14-30-21)28-12-4-5-13-28/h6-10,14-15,20H,3-5,11-13,16-17H2,1-2H3,(H,25,29)(H2,24,26,27) |
| InChIKey | MTKVCHPKOOVKKB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|