C23H34N6OS — CID 111011581
2-(dimethylamino)-N-[3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]acetamide (PubChem CID 111011581) has the molecular formula C23H34N6OS and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111011581 |
| Molecular Formula | C23H34N6OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]acetamide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)CN(C)C)c1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C23H34N6OS/c1-24-23(26-16-20(21-10-7-13-31-21)29-11-4-5-12-29)25-15-18-8-6-9-19(14-18)27-22(30)17-28(2)3/h6-10,13-14,20H,4-5,11-12,15-17H2,1-3H3,(H,27,30)(H2,24,25,26) |
| InChIKey | NLQZCCCLQCDIOD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|