C25H31N5O3 — CID 111304029
N-[3-[[[N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111304029) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-[3-[[[N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[[N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111304029 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | N-[3-[[[N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)c2ccco2)c1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C25H31N5O3/c1-26-25(28-18-21(22-10-6-14-32-22)30-12-3-2-4-13-30)27-17-19-8-5-9-20(16-19)29-24(31)23-11-7-15-33-23/h5-11,14-16,21H,2-4,12-13,17-18H2,1H3,(H,29,31)(H2,26,27,28) |
| InChIKey | QWDRZYGHGPUDPM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|