C22H31F2IN4O2 — CID 111304004
1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111304004) has the molecular formula C22H31F2IN4O2 and a molecular weight of 548.42 g/mol. Its IUPAC name is 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111304004 |
| Molecular Formula | C22H31F2IN4O2 |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(OCC(F)F)c1)NCC(c1ccco1)N1CCCCC1.I |
| InChI | InChI=1S/C22H30F2N4O2.HI/c1-25-22(26-14-17-7-5-8-18(13-17)30-16-21(23)24)27-15-19(20-9-6-12-29-20)28-10-3-2-4-11-28;/h5-9,12-13,19,21H,2-4,10-11,14-16H2,1H3,(H2,25,26,27);1H |
| InChIKey | RXXRHLSOJIEVBQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|