C22H30F2N4O2 — CID 111304005
1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine (PubChem CID 111304005) has the molecular formula C22H30F2N4O2 and a molecular weight of 420.50 g/mol. Its IUPAC name is 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111304005 |
| Molecular Formula | C22H30F2N4O2 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[[3-(2,2-difluoroethoxy)phenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cccc(OCC(F)F)c1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C22H30F2N4O2/c1-25-22(26-14-17-7-5-8-18(13-17)30-16-21(23)24)27-15-19(20-9-6-12-29-20)28-10-3-2-4-11-28/h5-9,12-13,19,21H,2-4,10-11,14-16H2,1H3,(H2,25,26,27) |
| InChIKey | RGDUOAMMLWXTFK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|