C23H31N5S — CID 111771608
1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111771608) has the molecular formula C23H31N5S and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111771608 |
| Molecular Formula | C23H31N5S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1cccc(N2CC=CC2)c1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C23H31N5S/c1-24-23(25-17-19-8-6-9-20(16-19)27-11-2-3-12-27)26-18-21(22-10-7-15-29-22)28-13-4-5-14-28/h2-3,6-10,15-16,21H,4-5,11-14,17-18H2,1H3,(H2,24,25,26) |
| InChIKey | FMLXVWGBBZKYTD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|