C23H32IN5OS — CID 111774601
1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111774601) has the molecular formula C23H32IN5OS and a molecular weight of 553.51 g/mol. Its IUPAC name is 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111774601 |
| Molecular Formula | C23H32IN5OS |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 1-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(N2CC=CC2)c1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C23H31N5OS.HI/c1-24-23(25-17-19-6-4-7-20(16-19)27-9-2-3-10-27)26-18-21(22-8-5-15-30-22)28-11-13-29-14-12-28;/h2-8,15-16,21H,9-14,17-18H2,1H3,(H2,24,25,26);1H |
| InChIKey | GATWALHCBZHOIS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|