C19H28IN5O3S2 — CID 111283952
2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111283952) has the molecular formula C19H28IN5O3S2 and a molecular weight of 565.50 g/mol. Its IUPAC name is 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111283952 |
| Molecular Formula | C19H28IN5O3S2 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(S(N)(=O)=O)c1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C19H27N5O3S2.HI/c1-21-19(22-13-15-4-2-5-16(12-15)29(20,25)26)23-14-17(18-6-3-11-28-18)24-7-9-27-10-8-24;/h2-6,11-12,17H,7-10,13-14H2,1H3,(H2,20,25,26)(H2,21,22,23);1H |
| InChIKey | FWJHJABXCHNNIE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|