C23H30N6OS — CID 111283927
1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283927) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283927 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1cccc(Cn2ccnc2)c1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C23H30N6OS/c1-24-23(26-15-19-4-2-5-20(14-19)17-28-8-7-25-18-28)27-16-21(22-6-3-13-31-22)29-9-11-30-12-10-29/h2-8,13-14,18,21H,9-12,15-17H2,1H3,(H2,24,26,27) |
| InChIKey | HXBMBUVWUCCUPY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|