C22H32FN5OS — CID 111830074
1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111830074) has the molecular formula C22H32FN5OS and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111830074 |
| Molecular Formula | C22H32FN5OS |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(F)c(CN(C)C)c1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C22H32FN5OS/c1-24-22(25-14-17-6-7-19(23)18(13-17)16-27(2)3)26-15-20(21-5-4-12-30-21)28-8-10-29-11-9-28/h4-7,12-13,20H,8-11,14-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | MCUTUXXDHCNDSG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|