C23H34FN5O — CID 111830156
1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine (PubChem CID 111830156) has the molecular formula C23H34FN5O and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111830156 |
| Molecular Formula | C23H34FN5O |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 1-[[3-[(dimethylamino)methyl]-4-fluorophenyl]methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(F)c(CN(C)C)c1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C23H34FN5O/c1-25-23(26-15-18-9-10-20(24)19(14-18)17-28(2)3)27-16-21(22-8-7-13-30-22)29-11-5-4-6-12-29/h7-10,13-14,21H,4-6,11-12,15-17H2,1-3H3,(H2,25,26,27) |
| InChIKey | WVUCRDPOTLOOIE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|