C20H26F2N4OS — CID 111284185
1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111284185) has the molecular formula C20H26F2N4OS and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111284185 |
| Molecular Formula | C20H26F2N4OS |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCCc1cc(F)cc(F)c1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C20H26F2N4OS/c1-23-20(24-5-4-15-11-16(21)13-17(22)12-15)25-14-18(19-3-2-10-28-19)26-6-8-27-9-7-26/h2-3,10-13,18H,4-9,14H2,1H3,(H2,23,24,25) |
| InChIKey | UKUHGZMPYWLEMO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|