C21H29FN4OS — CID 111966191
1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine (PubChem CID 111966191) has the molecular formula C21H29FN4OS and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 111966191 |
| Molecular Formula | C21H29FN4OS |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCC(c1cccs1)N1CCOC(C)C1 |
| InChI | InChI=1S/C21H29FN4OS/c1-16-15-26(11-12-27-16)19(20-4-3-13-28-20)14-25-21(23-2)24-10-9-17-5-7-18(22)8-6-17/h3-8,13,16,19H,9-12,14-15H2,1-2H3,(H2,23,24,25) |
| InChIKey | WWORBCJIAINTJL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|