C19H29IN4OS2 — CID 111966252
1-ethyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111966252) has the molecular formula C19H29IN4OS2 and a molecular weight of 520.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111966252 |
| Molecular Formula | C19H29IN4OS2 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 1-ethyl-3-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)NCC(c1cccs1)N1CCOC(C)C1.I |
| InChI | InChI=1S/C19H28N4OS2.HI/c1-3-20-19(21-12-16-6-4-10-25-16)22-13-17(18-7-5-11-26-18)23-8-9-24-15(2)14-23;/h4-7,10-11,15,17H,3,8-9,12-14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | XORLLFLUPNMCDD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|