C17H28N4OS — CID 111965961
1-ethyl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-prop-2-enylguanidine (PubChem CID 111965961) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-prop-2-enylguanidine.
| Compound Name | 1-ethyl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111965961 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-ethyl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CC(c1cccs1)N1CCOC(C)C1)NCC |
| InChI | InChI=1S/C17H28N4OS/c1-4-8-19-17(18-5-2)20-12-15(16-7-6-11-23-16)21-9-10-22-14(3)13-21/h4,6-7,11,14-15H,1,5,8-10,12-13H2,2-3H3,(H2,18,19,20) |
| InChIKey | OTUXRNFINJHMQK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|