C16H28N4OS — CID 111722041
1-butan-2-yl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine (PubChem CID 111722041) has the molecular formula C16H28N4OS and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-butan-2-yl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 1-butan-2-yl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 111722041 |
| Molecular Formula | C16H28N4OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-butan-2-yl-2-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]guanidine |
| SMILES | CCC(C)N/C(N)=N/CC(c1cccs1)N1CCOC(C)C1 |
| InChI | InChI=1S/C16H28N4OS/c1-4-12(2)19-16(17)18-10-14(15-6-5-9-22-15)20-7-8-21-13(3)11-20/h5-6,9,12-14H,4,7-8,10-11H2,1-3H3,(H3,17,18,19) |
| InChIKey | ZAFPLXJFBWSQNN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|