C16H28N4OS2 — CID 111966339
2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111966339) has the molecular formula C16H28N4OS2 and a molecular weight of 356.56 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111966339 |
| Molecular Formula | C16H28N4OS2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-(2-methylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCSC)NCC(c1cccs1)N1CCOC(C)C1 |
| InChI | InChI=1S/C16H28N4OS2/c1-13-12-20(7-8-21-13)14(15-5-4-9-23-15)11-19-16(17-2)18-6-10-22-3/h4-5,9,13-14H,6-8,10-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | MXHVDBATPWOXIP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|