C21H31N5OS — CID 109406424
2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109406424) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109406424 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-methyl-1-[2-(2-methylmorpholin-4-yl)-2-thiophen-2-ylethyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1ccncc1C)NCC(c1cccs1)N1CCOC(C)C1 |
| InChI | InChI=1S/C21H31N5OS/c1-16-13-23-8-6-18(16)7-9-24-21(22-3)25-14-19(20-5-4-12-28-20)26-10-11-27-17(2)15-26/h4-6,8,12-13,17,19H,7,9-11,14-15H2,1-3H3,(H2,22,24,25) |
| InChIKey | MVOWZUAYAYDRRI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|