C18H29ClFIN4OS — CID 111344820
1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111344820) has the molecular formula C18H29ClFIN4OS and a molecular weight of 530.88 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111344820 |
| Molecular Formula | C18H29ClFIN4OS |
| Molecular Weight | 530.88 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCC(c1c(F)cccc1Cl)N1CCOC(C)C1.I |
| InChI | InChI=1S/C18H28ClFN4OS.HI/c1-13-12-24(8-9-25-13)16(17-14(19)5-4-6-15(17)20)11-23-18(21-2)22-7-10-26-3;/h4-6,13,16H,7-12H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | FTBYMTFTYHJFKX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|