C18H27ClFN3O2 — CID 119849366
N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-4-(methylamino)butanamide (PubChem CID 119849366) has the molecular formula C18H27ClFN3O2 and a molecular weight of 371.88 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119849366 |
| Molecular Formula | C18H27ClFN3O2 |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCC(c1c(F)cccc1Cl)N1CCOC(C)C1 |
| InChI | InChI=1S/C18H27ClFN3O2/c1-13-12-23(9-10-25-13)16(11-22-17(24)7-4-8-21-2)18-14(19)5-3-6-15(18)20/h3,5-6,13,16,21H,4,7-12H2,1-2H3,(H,22,24) |
| InChIKey | SYDKFVUNQCDHPL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|