C20H21Cl2FN2O2 — CID 47035989
2-chloro-N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]benzamide (PubChem CID 47035989) has the molecular formula C20H21Cl2FN2O2 and a molecular weight of 411.30 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 47035989 |
| Molecular Formula | C20H21Cl2FN2O2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-chloro-N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]benzamide |
| SMILES | CC1CN(C(CNC(=O)c2ccccc2Cl)c2c(F)cccc2Cl)CCO1 |
| InChI | InChI=1S/C20H21Cl2FN2O2/c1-13-12-25(9-10-27-13)18(19-16(22)7-4-8-17(19)23)11-24-20(26)14-5-2-3-6-15(14)21/h2-8,13,18H,9-12H2,1H3,(H,24,26) |
| InChIKey | ZAGCDLRRBQVMBI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |