C19H21ClFN3O3 — CID 60513372
N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-oxidopyridin-1-ium-2-carboxamide (PubChem CID 60513372) has the molecular formula C19H21ClFN3O3 and a molecular weight of 393.85 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-oxidopyridin-1-ium-2-carboxamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-oxidopyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 60513372 |
| Molecular Formula | C19H21ClFN3O3 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-1-oxidopyridin-1-ium-2-carboxamide |
| SMILES | CC1CN(C(CNC(=O)c2cccc[n+]2[O-])c2c(F)cccc2Cl)CCO1 |
| InChI | InChI=1S/C19H21ClFN3O3/c1-13-12-23(9-10-27-13)17(18-14(20)5-4-6-15(18)21)11-22-19(25)16-7-2-3-8-24(16)26/h2-8,13,17H,9-12H2,1H3,(H,22,25) |
| InChIKey | VHIDBNDTWIYBOT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|