C22H29ClFN5O — CID 110968088
1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 110968088) has the molecular formula C22H29ClFN5O and a molecular weight of 433.96 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110968088 |
| Molecular Formula | C22H29ClFN5O |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCC(c1c(F)cccc1Cl)N1CCOC(C)C1 |
| InChI | InChI=1S/C22H29ClFN5O/c1-3-25-22(27-13-17-7-4-5-10-26-17)28-14-20(29-11-12-30-16(2)15-29)21-18(23)8-6-9-19(21)24/h4-10,16,20H,3,11-15H2,1-2H3,(H2,25,27,28) |
| InChIKey | JLGAKMKNSVBZJE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|