C18H26ClF4IN4O — CID 109472252
1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109472252) has the molecular formula C18H26ClF4IN4O and a molecular weight of 552.78 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109472252 |
| Molecular Formula | C18H26ClF4IN4O |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)-2-(2-methylmorpholin-4-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC(c1c(F)cccc1Cl)N1CCOC(C)C1.I |
| InChI | InChI=1S/C18H25ClF4N4O.HI/c1-12-11-27(8-9-28-12)15(16-13(19)4-3-5-14(16)20)10-26-17(24-2)25-7-6-18(21,22)23;/h3-5,12,15H,6-11H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | YYNVAJNQTBMRKU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|