C17H24ClF4IN4 — CID 109474314
1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474314) has the molecular formula C17H24ClF4IN4 and a molecular weight of 522.76 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474314 |
| Molecular Formula | C17H24ClF4IN4 |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC(c1c(F)cccc1Cl)N1CCCC1.I |
| InChI | InChI=1S/C17H23ClF4N4.HI/c1-23-16(24-8-7-17(20,21)22)25-11-14(26-9-2-3-10-26)15-12(18)5-4-6-13(15)19;/h4-6,14H,2-3,7-11H2,1H3,(H2,23,24,25);1H |
| InChIKey | NIHFQPCXHBZXOE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|