C17H22ClFN4 — CID 119149060
1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-prop-2-ynylguanidine (PubChem CID 119149060) has the molecular formula C17H22ClFN4 and a molecular weight of 336.84 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-prop-2-ynylguanidine.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 119149060 |
| Molecular Formula | C17H22ClFN4 |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)NCC(c1c(F)cccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C17H22ClFN4/c1-3-9-21-17(20-2)22-12-15(23-10-4-5-11-23)16-13(18)7-6-8-14(16)19/h1,6-8,15H,4-5,9-12H2,2H3,(H2,20,21,22) |
| InChIKey | LEFBUGVZXPRPBW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|