C18H24ClFN2O — CID 110623996
N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-cyclopropylpropanamide (PubChem CID 110623996) has the molecular formula C18H24ClFN2O and a molecular weight of 338.85 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-cyclopropylpropanamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-cyclopropylpropanamide |
|---|---|
| PubChem CID | 110623996 |
| Molecular Formula | C18H24ClFN2O |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-2-cyclopropylpropanamide |
| SMILES | CC(C(=O)NCC(c1c(F)cccc1Cl)N1CCCC1)C1CC1 |
| InChI | InChI=1S/C18H24ClFN2O/c1-12(13-7-8-13)18(23)21-11-16(22-9-2-3-10-22)17-14(19)5-4-6-15(17)20/h4-6,12-13,16H,2-3,7-11H2,1H3,(H,21,23) |
| InChIKey | WMCAKXUSHNWZEL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |