C20H22ClFN2O2 — CID 122030279
4-[[[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]benzoic acid (PubChem CID 122030279) has the molecular formula C20H22ClFN2O2 and a molecular weight of 376.86 g/mol. Its IUPAC name is 4-[[[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030279 |
| Molecular Formula | C20H22ClFN2O2 |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4-[[[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCC(c2c(F)cccc2Cl)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H22ClFN2O2/c21-16-4-3-5-17(22)19(16)18(24-10-1-2-11-24)13-23-12-14-6-8-15(9-7-14)20(25)26/h3-9,18,23H,1-2,10-13H2,(H,25,26) |
| InChIKey | BPNSPWCAFOBBGK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |