C13H19ClFN3O2S — CID 110623998
2-(2-chloro-6-fluorophenyl)-N-(methylsulfamoyl)-2-pyrrolidin-1-ylethanamine (PubChem CID 110623998) has the molecular formula C13H19ClFN3O2S and a molecular weight of 335.83 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(methylsulfamoyl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(methylsulfamoyl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 110623998 |
| Molecular Formula | C13H19ClFN3O2S |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(methylsulfamoyl)-2-pyrrolidin-1-ylethanamine |
| SMILES | CNS(=O)(=O)NCC(c1c(F)cccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C13H19ClFN3O2S/c1-16-21(19,20)17-9-12(18-7-2-3-8-18)13-10(14)5-4-6-11(13)15/h4-6,12,16-17H,2-3,7-9H2,1H3 |
| InChIKey | WEMQQLSHJTVLGQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |