C16H24ClFN2O2S — CID 60568452
N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide (PubChem CID 60568452) has the molecular formula C16H24ClFN2O2S and a molecular weight of 362.90 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 60568452 |
| Molecular Formula | C16H24ClFN2O2S |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCC(c1c(F)cccc1Cl)N1CCCC1 |
| InChI | InChI=1S/C16H24ClFN2O2S/c1-2-3-11-23(21,22)19-12-15(20-9-4-5-10-20)16-13(17)7-6-8-14(16)18/h6-8,15,19H,2-5,9-12H2,1H3 |
| InChIKey | NRNFTTAIMBCTIN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |