C21H28ClFN4O3 — CID 78868297
N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 78868297) has the molecular formula C21H28ClFN4O3 and a molecular weight of 438.93 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 78868297 |
| Molecular Formula | C21H28ClFN4O3 |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CC1(C)NC(=O)N(CCCC(=O)NCC(c2c(F)cccc2Cl)N2CCCC2)C1=O |
| InChI | InChI=1S/C21H28ClFN4O3/c1-21(2)19(29)27(20(30)25-21)12-6-9-17(28)24-13-16(26-10-3-4-11-26)18-14(22)7-5-8-15(18)23/h5,7-8,16H,3-4,6,9-13H2,1-2H3,(H,24,28)(H,25,30) |
| InChIKey | RTEGSYHBYWSZOG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|