C19H22ClFN4O — CID 55674374
N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 55674374) has the molecular formula C19H22ClFN4O and a molecular weight of 376.86 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55674374 |
| Molecular Formula | C19H22ClFN4O |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cn1cc(C=CC(=O)NCC(c2c(F)cccc2Cl)N2CCCC2)cn1 |
| InChI | InChI=1S/C19H22ClFN4O/c1-24-13-14(11-23-24)7-8-18(26)22-12-17(25-9-2-3-10-25)19-15(20)5-4-6-16(19)21/h4-8,11,13,17H,2-3,9-10,12H2,1H3,(H,22,26) |
| InChIKey | GPAQWVJKZDLXBF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|