C23H26N4O2 — CID 42889429
(E)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 42889429) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (E)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 42889429 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (E)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C23H26N4O2/c28-23(12-11-19-16-25-27(18-19)20-8-3-1-4-9-20)24-17-21(22-10-7-15-29-22)26-13-5-2-6-14-26/h1,3-4,7-12,15-16,18,21H,2,5-6,13-14,17H2,(H,24,28)/b12-11+ |
| InChIKey | JQQOXBPPBWQJGE-VAWYXSNFSA-N |
| XLogP | 3.82 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|