C21H25N5O2 — CID 26892299
N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methyl-2-phenyltriazole-4-carboxamide (PubChem CID 26892299) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methyl-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methyl-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 26892299 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]-5-methyl-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)NC[C@H](c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C21H25N5O2/c1-16-20(24-26(23-16)17-9-4-2-5-10-17)21(27)22-15-18(19-11-8-14-28-19)25-12-6-3-7-13-25/h2,4-5,8-11,14,18H,3,6-7,12-13,15H2,1H3,(H,22,27)/t18-/m1/s1 |
| InChIKey | SGLVHKAXSPLWRZ-GOSISDBHSA-N |
| XLogP | 3.13 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |