C17H23ClFN3O — CID 119849434
N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]pyrrolidine-2-carboxamide (PubChem CID 119849434) has the molecular formula C17H23ClFN3O and a molecular weight of 339.84 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119849434 |
| Molecular Formula | C17H23ClFN3O |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC(c1c(F)cccc1Cl)N1CCCC1)C1CCCN1 |
| InChI | InChI=1S/C17H23ClFN3O/c18-12-5-3-6-13(19)16(12)15(22-9-1-2-10-22)11-21-17(23)14-7-4-8-20-14/h3,5-6,14-15,20H,1-2,4,7-11H2,(H,21,23) |
| InChIKey | KSJFJXXQIAVUEL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |