C18H28Cl3N3O2 — CID 119849605
N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide;dihydrochloride (PubChem CID 119849605) has the molecular formula C18H28Cl3N3O2 and a molecular weight of 424.80 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119849605 |
| Molecular Formula | C18H28Cl3N3O2 |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC(c1ccccc1Cl)N1CCOCC1)C1CCCCN1 |
| InChI | InChI=1S/C18H26ClN3O2.2ClH/c19-15-6-2-1-5-14(15)17(22-9-11-24-12-10-22)13-21-18(23)16-7-3-4-8-20-16;;/h1-2,5-6,16-17,20H,3-4,7-13H2,(H,21,23);2*1H |
| InChIKey | GCHRZQNLEOMVKZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |